| Identification | |
| Name: | butyl prop-2-enoate; ethene; oxiran-2-ylmethyl 2-methylprop-2-enoate |
| Synonyms: | 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester, polymer with butyl 2-propenoate and ethene;2-Prppenoic acid, 2-methyl, oxiranylmethyl ester, polymer with butyl 2-propenoate and ethene;2-Propenoic acid, 2-methyl-, oxiranylmethyl ester, polymer with butyl 2-propenoate and ethene |
| CAS: | 51109-15-0 |
| Molecular Formula: | C16H26O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H10O3.C7H12O2.C2H4/c1-5(2)7(8)10-4-6-3-9-6;1-3-5-6-9-7(8)4-2;1-2/h6H,1,3-4H2,2H3;4H,2-3,5-6H2,1H3;1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 76.1°C |
| Boiling Point: | 189°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 76.1°C |
| Safety Data | |
 |
|
