| Identification | |
| Name: | (S)-(+)-Ibuprofen |
| Synonyms: | Benzeneaceticacid, a-methyl-4-(2-methylpropyl)-,(S)-;(+)-(S)-Ibuprofen;(+)-(S)-p-Isobutylhydratropic acid;(+)-Ibuprophen;(+)-a-Methyl-4-(2-methylpropyl)benzeneacetic acid;(S)-(+)-2-(4-Isobutylphenyl)propionic acid;(S)-(+)-p-Isobutylhydratropic acid;(S)-2-(4-Isobutylphenyl)propanoicacid;(aS)-a-Methyl-4-(2-methylpropyl)benzeneaceticacid;Nyfen;S-Optifen;Seractil;Ultraprofen;Benzeneacetic acid, a-methyl-4-(2-methylpropyl)-, (aS)-; |
| CAS: | 51146-56-6 |
| Molecular Formula: | C13H18O2 |
| Molecular Weight: | 206.28 |
| InChI: | InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 319.6 oC at 760 mmHg |
| Density: | 1.029 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 57 o (C=2, ETOH) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | colourless, crystalline solid |
| Specification: |
?Dexibuprofen (CAS NO.51146-56-6), its Synonyms are Dexibuprofene ; (+)-(S)-p-Isobutylhydratropic acid ; Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl)-, (S)- ; Dexibuprofeno [INN-Spanish] ; Dexibuprofenum?;?(S)-(+)-Ibuprofen .?It is colourless, crystalline solid. |
| Storage Temperature: | Store at RT |
| Color: | white |
| Usage: | A nonsteroidal anti-inflammatory drug (NSAID); activity resides primarily in the (S)-isomer |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
