| Identification | |
| Name: | Methyl 3-hydroxythiophene-2-carboxylate |
| Synonyms: | 2-(Carbomethoxy)-3-hydroxythiophene;3-Hydroxy-2-(methoxycarbonyl)thiophene;3-Hydroxy-2-thiophenecarboxylic acidmethyl ester;Methyl 3-hydroxy-2-thiophenecarboxylate;2-thiophenecarboxylic acid, 3-hydroxy-, methyl ester; |
| CAS: | 5118-06-9 |
| Molecular Formula: | C6H6O3S |
| Molecular Weight: | 158.17 |
| InChI: | InChI=1/C6H6O3S/c1-9-6(8)5-4(7)2-3-10-5/h2-3,7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.372 g/cm3 |
| Refractive index: | 1.579 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Methyl 3-hydroxythiophene-2-carboxylate , with CAS number of 5118-06-9, can be called Methyl-3-hydroxythiophen-2-carboxylat ; Methyl 3-hydroxythiophene-2-carboxylate ; 2-thiophenecarboxylic acid, 3-hydroxy-, methyl ester ; Methyl 3-hydroxy-2-thiophenecarboxylate ; 3-Hydroxy-2-thiophenecarboxylic acidmethyl ester ; 3-Hydroxy-2-(methoxycarbonyl)thiophene ; 2-(Carbomethoxy)-3-hydroxythiophene . It is a white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
