| Identification | |
| Name: | Dibenzofuran,2,3,7,8-tetrachloro- |
| Synonyms: | 2,3,7,8-TCDF;2,3,7,8-Tetrachlorodibenzofuran; F 83; PCDF 83; TCDF |
| CAS: | 51207-31-9 |
| Molecular Formula: | C12H4 Cl4 O |
| Molecular Weight: | 305.96 |
| InChI: | InChI=1/C12H4Cl4O/c13-7-1-5-6-2-8(14)10(16)4-12(6)17-11(5)3-9(7)15/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 208.6°C |
| Boiling Point: | 421.2°Cat760mmHg |
| Density: | 1.625g/cm3 |
| Refractive index: | 1.713 |
| Solubility: | In water, 6.92X10-4 mg/l @ 26 deg C |
| Specification: |
2,3,7,8-Tetrachlorodibenzofuran ,its cas register number is 51207-31-9. It also can be called 2,3,7,8-TCDF ;and Dibenzofuran, 2,3,7,8-tetrachloro- . 2,3,7,8-Tetrachlorodibenzofuran (CAS NO.51207-31-9) is toxic product which was generated in Italy due to an explosion in a plant manufacturing 2,4,5-trichlorophenol. |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | I |
| Flash Point: | 208.6°C |
| Color: | Crystals from 2,2,4-trimethylpentane |
| Safety Data | |
 |
|
