| Identification | |
| Name: | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane,1-[(2Z)-3-chloro-2-propen-1-yl]-, chloride (1:1) |
| Synonyms: | 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane,1-(3-chloro-2-propenyl)-, chloride, (Z)-;3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane, 1-[(2Z)-3-chloro-2-propenyl]-,chloride (9CI);cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride;cis-1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantantane chloride;1-(cis-3-Chloroallyl)-3,5,7-triaza-1-azonia-adamantane chloride;1-[(2Z)-3-Chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane chloride; |
| CAS: | 51229-78-8 |
| Molecular Formula: | C9H16Cl2N4 |
| Molecular Weight: | 251.15614 |
| InChI: | InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1/b2-1-; |
| Molecular Structure: | ![(C9H16Cl2N4) 3,5,7-Triaza-1-azoniatricyclo[3.3.1.13,7]decane,1-(3-chloro-2-propenyl)-, chloride, (Z)-;3,5,7-Triaz...](https://img1.guidechem.com/chem/e/dict/60/51229-78-8.jpg) |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Melting Point: | 178-210 deg C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable, but moisture sensitive. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. Toxicity data (The meaning of any toxicolog |
| Solubility: |
|
| Appearance: | solid |
| Specification: | solid Safety Statements:16-36 16:Keep away from sources of ignition - No smoking 36:Wear suitable protective clothing |
| Flash Point: | °C |
| Color: | White- to cream-colored powder |
| Safety Data | |
 |
|
