| Identification | |
| Name: | 2H-Isoindole-2-aceticacid, 1,3-dihydro-1,3-dioxo-a-(phenylmethyl)-, (aS)- |
| Synonyms: | 2-Isoindolineaceticacid, a-benzyl-1,3-dioxo-, (S)-(-)-(8CI); 2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-a-(phenylmethyl)-, (S)-;(S)-2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-3-phenylpropanoic acid;(S)-N-Phthaloylphenylalanine; (aS)-1,3-Dihydro-1,3-dioxo-a-(phenylmethyl)-2H-isoindole-2-acetic acid; N-Phthaloyl-(S)-phenylalanine;N-Phthaloyl-L-phenylalanine; Phthaloyl-L-phenylalanine |
| CAS: | 5123-55-7 |
| Molecular Formula: | C17H13 N O4 |
| Molecular Weight: | 295.29 |
| InChI: | InChI=1/C17H13NO4/c19-15-12-8-4-5-9-13(12)16(20)18(15)14(17(21)22)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,21,22)/t14-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.406 g/cm3 |
| Refractive index: | -216.5 ° (C=2, EtOH) |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
