| Identification |
| Name: | 4,4'-methylenebis(cyclohexyl isocyanate) |
| Synonyms: | 4,4-Methylenebis(cyclohexyl isocyanate),mixture of isomers; 4,4-methylenedicyclohexyl diisocyanate; Dicyclohexylmethane 4,4-Diisocyanate |
| CAS: | 5124-30-1 |
| EINECS: | 225-863-2 |
| Molecular Formula: | C15H22N2O2 |
| Molecular Weight: | 262.35 |
| InChI: | InChI=1/C15H22N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h12-15H,1-9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3080 |
| Boiling Point: | 168 °C / 1.5mmHg |
| Density: | 1.07 |
| Stability: | May slowly polymerize if heated above 50 C. |
| Refractive index: | n20/D 1.497(lit.) |
| Water Solubility: | Insoluble/Reactive |
| Solubility: | Insoluble/Reactive |
| Appearance: | Clear colorless to light-yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Clear, colorless to light-yellow liquid |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
