| Identification | |
| Name: | b-D-erythro-Pentofuranoside,methyl 2-deoxy- |
| Synonyms: | Methyl2-deoxy-b-D-erythro-pentofuranoside;Methyl 2-deoxy-b-D-ribofuranoside;Methyl b-D-2-deoxyribofuranoside;NSC 68139; |
| CAS: | 51255-18-6 |
| Molecular Formula: | C6H12O4 |
| Molecular Weight: | 148.16 |
| InChI: | InChI=1/C6H12O4/c1-9-6-2-4(8)5(3-7)10-6/h4-8H,2-3H2,1H3/t4-,5+,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.9°C |
| Boiling Point: | 294.5°Cat760mmHg |
| Density: | 1.24g/cm3 |
| Refractive index: | 1.487 |
| Specification: |
The Methyl-2-deoxy-beta-D-ribofuranoside, with the CAS registry number 51255-18-6, has the IUPAC name of 2-(hydroxymethyl)-5-methoxyoxolan-3-ol. And the molecular formula of the chemical is C6H12O4. The characteristics of this chemical are as followings: (1)ACD/LogP: -0.77; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 4#H ; (4)bond donors: 2; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 36.92 Å2; (7)Index of Refraction: 1.487; (8)Molar Refractivity: 34.26 cm3; (9)Molar Volume: 118.9 cm3; (10)Polarizability: 13.58×10-24cm3; (11)Surface Tension: 45.6 dyne/cm; (12)Density: 1.24 g/cm3; (13)Flash Point: 131.9 °C; (14)Enthalpy of Vaporization: 61.97 kJ/mol; (15)Boiling Point: 294.5 °C at 760 mmHg; (16)Vapour Pressure: 0.000169 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 131.9°C |
| Safety Data | |
 |
|
