| Identification | |
| Name: | 1-Propene, 2,3-dibromo- |
| Synonyms: | Propene,2,3-dibromo- (6CI,7CI,8CI); 1,2-Dibromo-2-propene; 2,3-Dibromo-1-propene;2,3-Dibromopropene; 2,3-Dibromopropylene; 2-Bromoallyl bromide; NSC 6200; a-Epidibromohydrin |
| CAS: | 513-31-5 |
| EINECS: | 208-155-8 |
| Molecular Formula: | C3H4 Br2 |
| Molecular Weight: | 199.87 |
| InChI: | InChI=1/C3H4Br2/c1-3(5)2-4/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 2.13 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.537-1.547 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear light yellow liquid |
| Specification: |
2,3-Dibromopropene (513-31-5) is a clear light yellow to brown liquid and insoluble in water. It is used in the synthesis of organic intermediate. It should keep in a cold drying place. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29033036 |
| Storage Temperature: | Freezer |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
