| Identification |
| Name: | 2-Methyl-2-propen-1-ol |
| Synonyms: | beta-Methallyl alcohol = 2-Methyl-2-propen-1-ol; Methallyl alcohol; Isopropenyl carbinol; 2-Methylallyl alcohol; 3-Hydroxy-2-methylpropene; |
| CAS: | 513-42-8 |
| EINECS: | 208-161-0 |
| Molecular Formula: | C4H8O |
| Molecular Weight: | 72.11 |
| InChI: | InChI=1/C4H8O/c1-4(2)3-5/h5H,1,3H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2614 |
| Density: | 0.857 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | 11 g/100 mL |
| Solubility: | 11 g/100 mL in water |
| Appearance: | Clear Liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Usage: | Used in the chemical process industry. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
