| Identification | |
| Name: | 1-Propanethiol,2-methyl- |
| Synonyms: | 1-Isobutanethiol;2-Methyl-1-propanethiol;2-Methylpropyl mercaptan;Isobutyl mercaptan;Isobutylthiol;NSC 203271; |
| CAS: | 513-44-0 |
| EINECS: | 208-162-6 |
| Molecular Formula: | C4H10S |
| Molecular Weight: | 90.18 |
| InChI: | InChI=1/C4H10S/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2347 3 |
| Flash Point: | °C |
| Refractive index: | 1.4388 |
| Water Solubility: | soluble in oil and alcohol |
| Solubility: | soluble in oil and alcohol |
| Appearance: | colourless liquid with cooked vegetable, mustard-like odour |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
