| Identification | |
| Name: | 2-Iodobutane |
| Synonyms: | S-BUTYL IODIDE; SEC-BUTYL IODIDE; 2-Butyl Iodide; 2-Butyliodide; 2-Iodbutan; 2-iodo-butan; 2-Jodbutan |
| CAS: | 513-48-4 |
| EINECS: | 208-163-1 |
| Molecular Formula: | C4H9I |
| Molecular Weight: | 184.02 |
| InChI: | InChI=1/C4H9I/c1-3-4(2)5/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2390 |
| Density: | 1.598 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. Light sensitive. |
| Refractive index: | 1.4991 |
| Solubility: | Insoluble |
| Appearance: | liquid |
| Specification: |
Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. Flammables-area.Wash thoroughly after handling. Wash hands before eating. Remove contaminated clothing and wash before reuse. Use only in a well ventilated area. Avoid contact with eyes, skin, and clothing. Empty containers retain product residue, (liquid and/or vapor), and can be dangerous. Avoid contact with heat, sparks and flame. Avoid ingestion and inhalation. Do not pressurize, cut, weld, braze, solder, drill, grind, or expose empty containers to heat, sparks or open flames. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| HS Code: | 29033080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Light Sensitive |
| Usage: | Used to make other chemicals and as a solvent. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
