| Identification | |
| Name: | Acetyl methyl carbinol |
| Synonyms: | 3-Hydroxy-2-butanone; acetoin, mixture of monomer and dimer; Acetoin (3-Hydroxy-2-butanone); 1-acetylethanol; Acetoin |
| CAS: | 513-86-0 |
| EINECS: | 208-174-1 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2621 |
| Density: | 1.013 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4171 |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble (miscible with alcohol, PG; Insoluble in fatty oils) |
| Appearance: | pale yellow to green yellow liquid or crystals |
| Packinggroup: | III |
| HS Code: | 29144090 |
| Color: | Slightly yellow liquid or crystals |
| Usage: | Synthetic flavoring in foods and non-alcoholic beverages. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
