| Identification | |
| Name: | 4-Thiazolemethanol,2-amino- |
| Synonyms: | (2-Aminothiazol-4-yl)methanol;2-Amino-4-(hydroxymethyl)thiazole; |
| CAS: | 51307-43-8 |
| Molecular Formula: | C4H6N2OS |
| Molecular Weight: | 130.17 |
| InChI: | InChI=1/C4H6N2OS/c5-4-6-3(1-7)2-8-4/h2,7H,1H2,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.873°C |
| Boiling Point: | 340.738°C at 760 mmHg |
| Density: | 1.475g/cm3 |
| Refractive index: | 1.682 |
| Appearance: | Pale yellow oil |
| Specification: |
(2-Aminothiazol-4-yl)methanol (51307-43-8) is pale yellow oil which belongs to the series of thiazole. (2-Aminothiazol-4-yl)methanol (51307-43-8) is also known as (2-Amino-1,3-thiazol-4-yl)methanol ; (2-Aminothiazol-4-yl)methanol ; 2-Amino-5-hydroxymethylthiazole ; 4-Hydroxymethyl-2-aminothiazole ; 2-Amino-4-hydroxymethylthiazole . |
| Flash Point: | 159.873°C |
| Safety Data | |
 |
|
