| Identification | |
| Name: | 2-(methylthio)phenyl isothiocyanate |
| Synonyms: | - |
| CAS: | 51333-75-6 |
| EINECS: | -0 |
| Molecular Formula: | C8H7NS2 |
| Molecular Weight: | 181.27 |
| InChI: | InChI=1/C8H7NS2/c1-11-8-5-3-2-4-7(8)9-6-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Flash Point: | >230 °F |
| Density: | 1.227 |
| Refractive index: | n20/D 1.695(lit.) |
| Specification: | Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | >230 °F |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
