| Identification | |
| CAS: | 51350-19-7 |
| Molecular Formula: | C14H23N5O |
| Molecular Weight: | 277.36532 |
| InChI: | InChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.27 g/cm3 |
| Water Solubility: | DMSO: 12 mg/mL |
| Solubility: | DMSO: 12 mg/mL |
| Appearance: | solid |
| Specification: | White Solid usageEng:A potent inhibitor of phosphodiesterase II (PDE II) (IC50=800nM). Does ot inhibit other PDE isozymes (IC50>100uM). Inhibits the retrograde transport motor, dynein. Also inhibits adenosine deaminase (Ki=4nM) |
| Biological Activity: | Selective inhibitor of cGMP-stimulated phosphodiesterase (PDE2) (IC 50 = 0.8 - 4 mM). Also a potent inhibitor of adenosine deaminase. |
| Storage Temperature: | 0-6°C |
| Color: | white |
| Usage: | A potent inhibitor of phosphodiesterase II (PDE II) (IC50=800nM). Does ot inhibit other PDE isozymes (IC50>100uM). Inhibits the retrograde transport motor, dynein. Also inhibits adenosine deaminase (Ki=4nM) |
| Safety Data | |
 |
|
