| Identification | |
| Name: | 3H-Purin-6-amine,3-methyl- |
| Synonyms: | Adenine,3-methyl- (7CI,8CI); 3-Methyl-6-aminopurine; 3-Methyladenine;6-Amino-3-methylpurine; N3-Methyladenine; NSC 66389 |
| CAS: | 5142-23-4 |
| EINECS: | 225-908-6 |
| Molecular Formula: | C6H7 N5 |
| Molecular Weight: | 149.15 |
| InChI: | InChI=1/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | ~300 °C (dec.)(lit.) |
| Flash Point: | 99°C |
| Boiling Point: | 240.1°C at 760 mmHg |
| Density: | 1.6g/cm3 |
| Refractive index: | 1.807 |
| Specification: | White powder usageEng:3-MA inhibits autophagy by blocking autophagosome formation via the inhibition of type III Phosphatidylinositol 3-kinases (PI-3K). For use as an autophagy inhibitor, 3-MA is typically used at a concentration of 5 mM. Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 99°C |
| Usage: | 3-MA inhibits autophagy by blocking autophagosome formation via the inhibition of type III Phosphatidylinositol 3-kinases (PI-3K). For use as an autophagy inhibitor, 3-MA is typically used at a concentration of 5 mM. |
| Safety Data | |
 |
|
