Identification |
Name: | 5-Bromo-2-fluorotoluene |
Synonyms: | 2-Fluoro-5-bromotoluene;5-Bromo-2-Fluoro Toluene;4-bromo-1-fluoro-2-methyl-benzene; |
CAS: | 51437-00-4 |
EINECS: | 257-202-9 |
Molecular Formula: | C7H6BrF |
Molecular Weight: | 189.03 |
InChI: | InChI=1/C7H6BrF/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.486 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.528-1.53 |
Water Solubility: | INSOLUBLE |
Solubility: | INSOLUBLE |
Appearance: | Clear, colorless liquid. |
HS Code: | 29036990 |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |