| Identification |
| Name: | 2,6-Octadienenitrile,3,7-dimethyl- |
| Synonyms: | (E/Z)-Geranonitrile;3,7-Dimethyl-2,6-octadienenitrile; Citralva; Citronitrile; Geranyl nitrile |
| CAS: | 5146-66-7 |
| EINECS: | 225-918-0 |
| Molecular Formula: | C10H15 N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6H2,1-3H3/b10-7+ |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Density: | 0.85 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.472-1.476 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | SLIGHTLY SOLUBLE |
| Appearance: | Colourless to pale yellow oily liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
