| Identification | |
| Name: | Acetic acid,2-amino-2-oxo-, hydrazide |
| Synonyms: | Aceticacid, aminooxo-, hydrazide (9CI); Semioxamazide (6CI,7CI,8CI); Aminooxamide;Carbamoylformic acid hydrazide; N-Aminooxamide; NSC 45889; Oxamic acidhydrazide; Oxamic hydrazide; Semioxamazid |
| CAS: | 515-96-8 |
| EINECS: | 208-213-2 |
| Molecular Formula: | C2H5 N3 O2 |
| Molecular Weight: | 103.10 |
| InChI: | InChI=1/C2H5N3O2/c3-1(6)2(7)5-4/h4H2,(H2,3,6)(H,5,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 216-218 °C (dec.)(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.432g/cm3 |
| Refractive index: | 1.524 |
| Specification: |
2-Hydrazinyl-2-oxoacetamide with CAS number of 515-96-8 is also called for Aminooxo-aceticacihydrazide ; Carbamoylformicacidhydrazide ; N-Aminooxamide ; Semioxamazid ; Labotest-bb lt00848024 ; Amino-oxamide ; Semioxamazide ; Oxamic acid hydrazide . If victim is conscious and alert, give 2-4 cupfuls of milk or water. Get medical aid immediately. Get medical aid immediately. Remove from exposure and move to fresh air immediately. If not breathing, give artificial respiration. If breathing is difficult, give oxygen. Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation. Store in a cool, dry place. Keep container closed when not in use. |
| Flash Point: | °C |
| Safety Data | |
 |
|
