| Identification |
| Name: | Phenol, 2,3-dimethoxy- |
| Synonyms: | 1-Hydroxy-2,3-dimethoxybenzene;2,3-Dimethoxyphenol; NSC 80659 |
| CAS: | 5150-42-5 |
| EINECS: | 225-922-2 |
| Molecular Formula: | C8H10 O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-10-7-5-3-4-6(9)8(7)11-2/h3-5,9H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.182 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5385-1.5405 |
| Appearance: | clear orange to brown liquid. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
