Identification |
Name: | Phenol, 2,3-dimethoxy- |
Synonyms: | 1-Hydroxy-2,3-dimethoxybenzene;2,3-Dimethoxyphenol; NSC 80659 |
CAS: | 5150-42-5 |
EINECS: | 225-922-2 |
Molecular Formula: | C8H10 O3 |
Molecular Weight: | 154.16 |
InChI: | InChI=1/C8H10O3/c1-10-7-5-3-4-6(9)8(7)11-2/h3-5,9H,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.182 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5385-1.5405 |
Appearance: | clear orange to brown liquid. |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |