| Identification | |
| Name: | 2-Amino-6-hydroxypyridine |
| Synonyms: | 2-Pyridinol,6-amino- (8CI);(6-Hydroxypyridin-2-yl)amine; |
| CAS: | 5154-00-7 |
| EINECS: | 261-697-7 |
| Molecular Formula: | C5H6N2O |
| Molecular Weight: | 110.11 |
| InChI: | InChI=1S/C5H6N2O/c6-4-2-1-3-5(8)7-4/h1-3H,(H3,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.208 g/cm3 |
| Specification: | crystal Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| HS Code: | 29333999 |
| Safety Data | |
| Hazard Symbols |
T: Toxic
Xn: Harmful
|
 |
|
