Identification |
Name: | 2-Amino-6-hydroxypyridine |
Synonyms: | 2-Pyridinol,6-amino- (8CI);(6-Hydroxypyridin-2-yl)amine; |
CAS: | 5154-00-7 |
EINECS: | 261-697-7 |
Molecular Formula: | C5H6N2O |
Molecular Weight: | 110.11 |
InChI: | InChI=1S/C5H6N2O/c6-4-2-1-3-5(8)7-4/h1-3H,(H3,6,7,8) |
Molecular Structure: |
 |
Properties |
Density: | 1.208 g/cm3 |
Specification: | crystal Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 36:Wear suitable protective clothing |
HS Code: | 29333999 |
Safety Data |
Hazard Symbols |
T: Toxic
Xn: Harmful
|
|
 |