| Identification | |
| Name: | Benzoic acid,2-chloro-5-(methylthio)- |
| Synonyms: | 2-Chloro-5-(methylthio)benzoicacid; 2-Chloro-5-methylsulfanylbenzoic acid |
| CAS: | 51546-12-4 |
| Molecular Formula: | C8H7 Cl O2 S |
| Molecular Weight: | 202.66 |
| InChI: | InChI=1/C8H7ClO2S/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.42 |
| Refractive index: | 1.627 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
