| Identification | |
| Name: | 1H-Indole-3-acetonitrile,1-methyl- |
| Synonyms: | Indole-3-acetonitrile,1-methyl- (7CI);3-(Cyanomethyl)-1-methylindole;N-Methylindole-3-acetonitrile; |
| CAS: | 51584-17-9 |
| Molecular Formula: | C11H10N2 |
| Molecular Weight: | 170.21 |
| InChI: | InChI=1/C11H10N2/c1-13-8-9(6-7-12)10-4-2-3-5-11(10)13/h2-5,8H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.06 g/cm3 |
| Refractive index: | 1.591 |
| Appearance: | Yellowish solid or liquid |
| Specification: |
The 1-Methylindole-3-acetonitrile is an organic compound with the formula C11H10N2. The systematic name od this chemical is (1-methyl-1H-indol-3-yl)acetonitrile. With the CAS registry number 51584-17-9, it is also named as 1H-indole-3-acetonitrile, 1-methyl-. It is off-white to light brown solid which is used as pharmaceutical intermediate. The other characteristics of this product can be summarized as: (1)ACD/LogP: 1.36; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 13; (6)ACD/BCF (pH 7.4): 13; (7)ACD/KOC (pH 5.5): 219; (8)ACD/KOC (pH 7.4): 219; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1 ; (12)Index of Refraction: 1.591; (13)Molar Refractivity: 53.825 cm3; (14)Molar Volume: 159.273 cm3; (15)Polarizability: 21.338×10-24 cm3; (16)Surface Tension: 41.079 dyne/cm; (17)Flash Point: 168.203 °C; (18)Enthalpy of Vaporization: 59.956 kJ/mol; (19)Boiling Point: 354.512 °C at 760 mmHg; (20)Vapour Pressure: 0 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
