| Identification | |
| Name: | 2-Chlorobenzophenone |
| Synonyms: | Benzophenone,2-chloro- (6CI,7CI,8CI);(2-Chlorophenyl)(phenyl)methanone;2-Benzoylphenylchloride;Methanone,(2-chlorophenyl)phenyl-;2-Chlorophenyl phenyl ketone;NSC 62529;o-Chlorobenzophenone; |
| CAS: | 5162-03-8 |
| EINECS: | 225-936-9 |
| Molecular Formula: | C13H9ClO |
| Molecular Weight: | 216.67 |
| InChI: | InChI=1/C13H9ClO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.207 g/cm3 |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | white to yellow crystalline powder |
| Specification: |
2-Chlorobenzophenone (CAS NO.5162-03-8) is also named as (2-Chlorophenyl)phenylmethanone ; 2-Chlorobenyl phenyl ketone ; AI3-22112 ; NSC 62529 ; o-Chlorobenzophenone ; Benzophenone, 2-chloro- (6CI,7CI,8CI) ; Methanone, (2-chlorophenyl)phenyl- . 2-Chlorobenzophenone (CAS NO.5162-03-8) is white to yellow crystalline powder. |
| Safety Data | |
| Hazard Symbols | |
 |
|
