| Identification | |
| Name: | 4-Iodophenylacetonitrile |
| Synonyms: | 4-Iodobenzyl cyanide |
| CAS: | 51628-12-7 |
| EINECS: | -0 |
| Molecular Formula: | C8H6IN |
| Molecular Weight: | 243.04 |
| InChI: | InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3335 |
| Density: | 1.764 g/cm3 |
| Refractive index: | 1.624 |
| Specification: |
4-Iodophenylacetonitrile , its cas register number is 51628-12-7. It also can be called Benzeneacetonitrile, 4-iodo- ; 4-Iodobenzyl cyanide . 4-Iodophenylacetonitrile (CAS NO.51628-12-7) is harmful if swallowed. And it may cause sensitization by skin contact. |
| Packinggroup: | III |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
