| Identification | |
| Name: | 5-Methyl-3-hexen-2-one |
| Synonyms: | - |
| CAS: | 5166-53-0 |
| EINECS: | 225-950-5 |
| Molecular Formula: | C7H12O |
| Molecular Weight: | 112.17 |
| InChI: | InChI=1/C7H12O/c1-6(2)4-5-7(3)8/h4-6H,1-3H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 3/PG 3 |
| Flash Point: | 47.5°C |
| Boiling Point: | 150.7°Cat760mmHg |
| Density: | 0.829g/cm3 |
| Refractive index: | n20/D 1.44(lit.) |
| Specification: | Safety Statements:16-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 47.5°C |
| Safety Data | |
 |
|
