| Identification |
| Name: | Oxirane, methyl-, polymer with oxirane, octadecanoate |
| Synonyms: | Oxirane, methyl-, polymer with oxirane, octadecanoate;Stearinsure, ethoxiliert, propoxiliert, EO 35 mol und PO 35 mol |
| CAS: | 51668-30-5 |
| Molecular Formula: | C23H46O4 |
| Molecular Weight: | 386.60894 |
| InChI: | InChI=1S/C18H36O2.C3H6O.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-2-4-3;1-2-3-1/h2-17H2,1H3,(H,19,20);3H,2H2,1H3;1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
