| Identification |
| Name: | 2-Acetylbutyrolactone |
| Synonyms: | 3-Acetyl-dihydro-2(3H)-furanone; ABL; 3-Acetyl-4,5-dihydro-2(3H)-furanone; alpha-Acetyl-gamma-butyrolactone; 2-Acetyl-Sulfo-gamma-butyrolactone |
| CAS: | 517-23-7 |
| EINECS: | 208-235-2 |
| Molecular Formula: | C6H8O3 |
| Molecular Weight: | 128.13 |
| InChI: | InChI=1/C6H8O3/c1-4(7)5-2-3-9-6(5)8/h5H,2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 240kgs |
| Melting Point: | BOLING |
| Density: | 1.185 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.4585 |
| Solubility: | 200 g/l at 20 C |
| Appearance: | clear to slightly yellow liquid |
| HS Code: | 29322980 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
