| Identification | |
| Name: | Urea,N-phenyl-N'-1,2,3-thiadiazol-5-yl- |
| Synonyms: | 1,2,3-Thiadiazole,urea deriv.;1-Phenyl-3-(1,2,3-thiadiazol-5-yl)urea;Avguron;Dropp;Dropp SC;Lift;N-Phenyl-N'-1,2,3-thiadiazol-5-ylurea;SN 49537;TAG (plant growthregulator);TDZ; |
| CAS: | 51707-55-2 |
| EINECS: | 257-356-7 |
| Molecular Formula: | C9H8N4OS |
| Molecular Weight: | 220.25 |
| InChI: | InChI=1/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.51 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.754 |
| Solubility: | Slightly soluble |
| Appearance: | white odourless crystalline solid |
| Specification: | Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | °C |
| Color: | Colorless crystals |
| Usage: | Cotton defoliant. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
