| Identification | |
| Name: | 2(3H)-Furanone,5-(4-fluorophenyl)dihydro- |
| Synonyms: | 5-(4-Fluorophenyl)tetrahydrofuran-2-one;5-(4-Fluorophenyl)dihydro-2(3H)-furanone;4-(4-Fluorophenyl)butyrolactone;g-(4-Fluorophenyl)-g-butyrolactone;gamma-(4-Fluorophenyl)-gamma-butyrolactone;AC1L2UZA;AC1Q4NP2;AR-1G5287; |
| CAS: | 51787-96-3 |
| EINECS: | 257-422-5 |
| Molecular Formula: | C10H9FO2 |
| Molecular Weight: | 180.18 |
| InChI: | InChI=1/C10H9FO2/c11-8-3-1-7(2-4-8)9-5-6-10(12)13-9/h1-4,9H,5-6H2/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.245g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.52 (20 C) |
| Appearance: | Clear, colorless liquid. |
| Specification: |
4,5-Dihydro-5-(4-fluorophenyl)-2(3H)-furanone (CAS NO.51787-96-3) can also be called as 2(3H)-furanone, 5-(4-fluorophenyl)dihydro- ; 5-(4-Fluorophenyl)-dihydro-2(3h)furanone ; 5-(4-Fluorophenyl)dihydro-2(3h)-furanone ; Gamma-(4-fluorophenyl)-butyrolactone ; 4-(4-Fluorobenzoyl)butyrolactone ; Gamma-(4-fluorophenyl)-gamma-butyrolactone ; 4-(4-Fluorobenzoyl)butyrol acetone . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
