| Identification | ||
| Name: | Emodin | |
| Synonyms: | 6-Methyl-1,3,8-trihydroxyanthraquinone;Frangula emodin;1,3, 8-Trihydroxy-6-methylanthraquinone;6-Methyl-1,3,8-trihydroxy-9,10-anthracenedione;1,3, 8-Trihydroxy-6-methyl-9,10-anthraquinone;9,10-Anthracenedione,1,3,8-trihydroxy-6- methyl-;Anthraquinone, 6-methyl-1,3,8-trihydroxy-;Anthraquinone, 1,3,8-trihydroxy-6-methyl-;Rheum emodin;1,3,8-Trihydroxy-6-methyl-9,10-anthracenedione;9,10-Anthracenedione, 1,3,8-trihydroxy-6-methyl-;C.I. 75440;9,10-Anthracenedione, 1,3,8-trihydroxy-6-methyl- (9CI);1,3,8-Trihydroxy-6-methylanthraquinone;3-Methyl-1,6, 8-trihydroxyanthraquinone;Huperzines A;Polygonum Cuspidatum P.E;Emodine; | |
| CAS: | 518-82-1 | |
| EINECS: | 208-258-8 | |
| Molecular Formula: | C15H10O5 | |
| Molecular Weight: | 270.24 | |
| InChI: | InChI=1/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.583 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Water Solubility: | ||
| Appearance: | red-orange powder | |
| Specification: |
? Emodin , with CAS number of 518-82-1, can be called 1,3,8-Trihydroxy-6-methylanthraquinone ; 6-Methyl-1,3,8-trihydroxyanthraquinone ; C.I. 75440 ; C.I. Natural Yellow 14 ; 1,3,8-Trihydroxy-6-methylanthraquinone ; 1,3,8-trihydroxy-6-methylanthra-9,10-quinone . Emodin (CAS NO.518-82-1)? is a purgative resin from rhubarb and the buckthorn. The term may also refer to any one of a series of principles isomeric with the emodin of rhubarb. When heated to decomposition Emodin emits acrid smoke and irritating fumes. | |
| Report: |
EPA Genetic Toxicology Program. | |
| Biological Activity: | Naturally occurring anthraquinone that displays a range of biological activities. Exhibits anti-inflammatory, antitumor and neuroprotective effects. | |
| Color: | orange | |
| Usage: | Formerly used as a laxative. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
