| Identification | |
| Name: | 3-MATIDA |
| Synonyms: | 3-MATIDA;ALPHA-AMINO-5-CARBOXY-3-METHYL-2-THIOPHENEACETIC ACID |
| CAS: | 518357-51-2 |
| Molecular Formula: | C8H9NO4S |
| Molecular Weight: | 215.23 |
| InChI: | InChI=1/C8H9NO4S/c1-3-2-4(7(10)11)14-6(3)5(9)8(12)13/h2,5H,9H2,1H3,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 232.766°C |
| Boiling Point: | 461.266°C at 760 mmHg |
| Density: | 1.542g/cm3 |
| Refractive index: | 1.652 |
| Biological Activity: | Potent metabotropic glutamate mGlu 1 receptor antagonist (IC 50 = 6.3 μ M at rat mGlu 1a ). Displays ≥ 40-fold selectivity over other receptors: mGlu 5 , mGlu 2 , mGlu 4a (IC 50 > 300 μ M), NMDA and AMPA (IC 50 = 250 μ M). Neuroprotective in cultured murine cortical cells and rat hippocampal slice cultures in vitro . Reduces the volume of ischemia-induced brain infarcts in rats following systemic administration in vivo . |
| Flash Point: | 232.766°C |
| Safety Data | |
 |
|
