| Identification | |
| Name: | N,N-Diphenylacetamide |
| Synonyms: | Acetyldiphenylamine;Diphenylacetamide; N,N-Diphenylacetamide; N-Acetyldiphenylamine;N-Phenylacetanilide; NSC 3133 |
| CAS: | 519-87-9 |
| EINECS: | 208-277-1 |
| Molecular Formula: | C14H13NO |
| Molecular Weight: | 211.2628 |
| InChI: | InChI=1/C14H13NO/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 100-103 °C(lit.) |
| Flash Point: | 199.7°C |
| Boiling Point: | 130 °C0.02 mm Hg(lit.) |
| Density: | 1.125g/cm3 |
| Refractive index: | 1.609 |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 199.7°C |
| Safety Data | |
 |
|
