| Identification | |
| Name: | 29154-49-2 |
| Synonyms: | dimethyl benzene-1,4-dicarboxylate; ethylene glycol; 2-(2-hydroxyethoxy)ethanol;29154-49-2;AC1L52P4;AC1Q5Z70;Diethylene glycol, ethylene glycol, dimethyl terephthalate polymer;AR-1I5628;dimethyl benzene-1,4-dicarboxylate; ethane-1,2-diol; 2-(2-hydroxyethoxy)ethanol;1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester, polymer with 1,2-ethanediol and 2,2'-oxybis(ethanol);1,4-Benzenedicarboxylic acid, dimethyl ester, polymer with 1,2-ethanediol and 2,2'-oxybis(ethanol) |
| CAS: | 51910-48-6 |
| Molecular Formula: | C16H26O9 |
| Molecular Weight: | 362.37224 |
| InChI: | InChI=1S/C10H10O4.C4H10O3.C2H6O2/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;5-1-3-7-4-2-6;3-1-2-4/h3-6H,1-2H3;5-6H,1-4H2;3-4H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148°C |
| Boiling Point: | 285°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 148°C |
| Safety Data | |
 |
|
