Identification |
Name: | Hexadecanoic acid,1,1'-[1-(chloromethyl)-1,2-ethanediyl] ester |
Synonyms: | Hexadecanoicacid, 1-(chloromethyl)-1,2-ethanediyl ester (9CI); 3-Chloropropane-1,2-dioldipalmitate |
CAS: | 51930-97-3 |
Molecular Formula: | C35H67 Cl O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C35H67ClO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(37)39-32-33(31-36)40-35(38)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33H,3-32H2,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 62-640C |
Flash Point: | 130.7°C |
Boiling Point: | 624.1°Cat760mmHg |
Density: | 0.939g/cm3 |
Refractive index: | 1.464 |
Specification: | White Solid usageEng:A fatty acid esters of 3-chloropropane-1,2-diol |
Flash Point: | 130.7°C |
Usage: | A fatty acid esters of 3-chloropropane-1,2-diol |
Safety Data |
|
|