Identification |
Name: | CCRIS 4770 |
Synonyms: | paraffin chlorinated;CHLOROWAX40; |
CAS: | 51990-12-6 |
Molecular Formula: | C24H43Cl7 |
Molecular Weight: | 579.77 |
InChI: | InChI=1/C10H16Cl6/c1-3-6(12)4-7(13)9(15)10(16)8(14)5(2)11/h5-10H,3-4H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Boiling Point: | 399.9°C at 760 mmHg |
Density: | 1.16-1.18 |
Refractive index: | 1.496 |
Packinggroup: | Z01 |
Color: | Generally they are viscous liquids. Light yellow to amber, thick, oily liquid. Colorless to pale yellow liquids |
Safety Data |
|
 |