| Identification | |
| Name: | Morphinan-3,6-diol,7,8-didehydro-4,5-epoxy-17-methyl- (5a,6a)-, hydrochloride (1:1) |
| Synonyms: | Morphinan-3,6-diol,7,8-didehydro-4,5-epoxy-17-methyl- (5a,6a)-, hydrochloride (9CI); Morphinan-3,6a-diol, 7,8-didehydro-4,5a-epoxy-17-methyl-, hydrochloride (8CI); (-)-Morphinehydrochloride; Ampek; Epimore; Morphine chlorhydrate; Morphine hydrochloride;Morphine monohydrochloride; Opso; Pacif; Pacif capsules; Theba-Intran;Thebametten |
| CAS: | 52-26-6 |
| EINECS: | 200-136-2 |
| Molecular Formula: | C17H19 N O3 . Cl H |
| Molecular Weight: | 321.83 |
| InChI: | InChI=1/C17H19NO3.ClH/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;/h2-5,10-11,13,16,19-20H,6-8H2,1H3;1H/t10-,11+,13-,16-,17-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Flash Point: | 241.8°C |
| Boiling Point: | 476.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Safety Statements:7-16-24-33-36/37-45 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 24:Avoid contact with skin 33:Take precautionary measures against static discharges 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 241.8°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
