| Identification | |
| Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5,5-di-2-propen-1-yl- |
| Synonyms: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5,5-di-2-propenyl- (9CI); Barbituric acid, 5,5-diallyl- (8CI); 5,5-Diallylbarbituricacid; Allobarbital; Allobarbitone; Allylbarbitural; Alnox; Barballyl; Barbidal;Curral; Diadol; Dial; Dial (barbiturate); Diallylbarbital; Diallylbarbituricacid; Diallymal; Dorm; Dormallyl; Malil; Malilum; NSC 9324; Novallyl |
| CAS: | 52-43-7 |
| EINECS: | 200-140-4 |
| Molecular Formula: | C10H12 N2 O3 |
| Molecular Weight: | 208.24 |
| InChI: | InChI=1/C10H12N2O3/c1-3-5-11-8(13)7-9(14)12(6-4-2)10(11)15/h3-4H,1-2,5-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.126g/cm3 |
| Refractive index: | 1.516 |
| Specification: | usageEng:Allobarbital is a barbiturate derivative that is primarily used as an anticonvulsant. Allobarbital also shows hypnotic activity and is used to boost the activity of analgesic drugs. Studies show that Allobarbital is an effective promoters of hepatocarcinogenesis. Allobarbital is a Controlled Substance. Safety Statements:45 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Usage: | Allobarbital is a barbiturate derivative that is primarily used as an anticonvulsant. Allobarbital also shows hypnotic activity and is used to boost the activity of analgesic drugs. Studies show that Allobarbital is an effective promoters of hepatocarcinogenesis. Allobarbital is a Controlled Substance. |
| Safety Data | |
| Hazard Symbols | |
 |
|
