| Identification | |
| Name: | 4H-1-Benzopyran-4-one,3,5,7-trihydroxy-2-(4-hydroxyphenyl)- |
| Synonyms: | Flavone,3,4',5,7-tetrahydroxy- (7CI,8CI);3,4',5,7-Tetrahydroxyflavone;3'-Deoxyquercetin;5,7,4'-Trihydroxyflavonol;C.I. 75640;Indigo Yellow;Kaempferol;Kaempherol;Kampcetin;Kempferol;NSC 407289;NSC 656277;Nimbecetin;Pelargidenolon;Pelargidenon;Populnetin;Rhamnolutein;Rhamnolutin;Robigenin;Swartziol;Trifolitin; |
| CAS: | 520-18-3 |
| EINECS: | 208-287-6 |
| Molecular Formula: | C15H10O6 |
| Molecular Weight: | 286.2363 |
| InChI: | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.688 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.767 |
| Water Solubility: | ethanol: 20 mg/mL in water |
| Solubility: | ethanol: 20 mg/mL in water |
| Appearance: | Yellow powder |
| Specification: | Yellow Solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Color: | yellow |
| Usage: | Induces significant nuclear dna degradation concurrent with lipid peroxidation. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
