| Identification | |
| Name: | 4H-1-Benzopyran-4-one,5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)- |
| Synonyms: | Diosmetin(6CI);Flavone, 3',5,7-trihydroxy-4'-methoxy- (7CI,8CI);3',5,7-Trihydroxy-4'-methoxyflavone;4'-Methylluteolin;Diosmetol;Luteolin 4'-methylether;Pillon; |
| CAS: | 520-34-3 |
| EINECS: | 208-291-8 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 300.2629 |
| InChI: | InChI=1/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.512 g/cm3 |
| Refractive index: | 1.697 |
| Appearance: | Yellow powder |
| Specification: |
4H-1-Benzopyran-4-one,5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)- , its cas register number is 520-34-3. It also can be called 5,7,3'-Trihydroxy-4'-methoxyflavone ; Diosmetin ; UNII-TWZ37241OT . 4H-1-Benzopyran-4-one,5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)- (CAS NO.520-34-3) is a yellow powder. |
| Storage Temperature: | -20?C Freezer |
| Usage: |
A metabolite of Apigenin. Antibacterial. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
