| Identification |
| Name: | 2-hydroxyethyl 2-methylprop-2-enoate; isobutyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate |
| Synonyms: | AC1L56UZ;2-Hydroxyethyl methacrylate, methyl methacrylate, isobutyl methacrylate polymer;2-hydroxyethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; 2-methylpropyl 2-methylprop-2-enoate;2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with methyl 2-methyl-2-propenoate and 2-methylpropyl 2-methyl-2-propenoate;52002-56-9 |
| CAS: | 52002-56-9 |
| Molecular Formula: | C19H32O7 |
| Molecular Weight: | 372.4532 |
| InChI: | InChI=1/C8H14O2.C6H10O3.C5H8O2/c1-6(2)5-10-8(9)7(3)4;1-5(2)6(8)9-4-3-7;1-4(2)5(6)7-3/h6H,3,5H2,1-2,4H3;7H,1,3-4H2,2H3;1H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 44.4°C |
| Boiling Point: | 155°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 44.4°C |
| Safety Data |
| |
 |
