| Identification | |
| Name: | 6-(morpholino)pyridin-3-amine |
| Synonyms: | 6-morpholinopyridin-3-amine |
| CAS: | 52023-68-4 |
| EINECS: | 257-613-3 |
| Molecular Formula: | C9H13N3O |
| Molecular Weight: | 179.22 |
| InChI: | InChI=1/C9H13N3O/c10-8-1-2-9(11-7-8)12-3-5-13-6-4-12/h1-2,7H,3-6,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 414.4°Cat760mmHg |
| Boiling Point: | 414.4°Cat760mmHg |
| Density: | 1.208g/cm3 |
| Specification: |
3-Pyridinamine,6-(4-morpholinyl)- , its cas register number is 52023-68-4. It also can be called 6-(Morpholino)pyridin-3-amine . 3-Pyridinamine,6-(4-morpholinyl)- (CAS NO.52023-68-4) is harmful by inhalation, in contact with skin and if swallowed. You should wear suitable protective clothing, gloves and eye/face protection. |
| Flash Point: | 414.4°Cat760mmHg |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
