Identification |
Name: | Benzeneacetic acid, a-(3-hydroxy-5-oxo-4-phenyl-2(5H)-furanylidene)-,methyl ester, (aE)- |
Synonyms: | Benzeneaceticacid, a-(3-hydroxy-5-oxo-4-phenyl-2(5H)-furanylidene)-,methyl ester, (E)-; Vulpinic acid (6CI); D2(5H),a-Furanacetic acid, 3-hydroxy-5-oxo-a,4-diphenyl-, methyl ester (8CI); NSC 5897 |
CAS: | 521-52-8 |
EINECS: | 208-314-1 |
Molecular Formula: | C19H14 O5 |
Molecular Weight: |
322.31 |
InChI: | InChI=1/C19H14O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,20H,1H3/b17-15+ |
Molecular Structure: |
|
Properties |
Transport: | 3172 |
Melting Point: | 146-148°C |
Flash Point: | 210.2°C |
Boiling Point: | 568.8°Cat760mmHg |
Density: | 1.375g/cm3 |
Refractive index: | 1.656 |
Specification: | Yellow Solid usageEng:A lichen metabolite with anti-inflammatory properties Safety Statements:1-22-45 1:Keep locked up 22:Do not breathe dust 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 210.2°C |
Usage: | A lichen metabolite with anti-inflammatory properties |
Safety Data |
|
|