| Identification | |
| Name: | Trimipramine maleate |
| Synonyms: | trimipraminehydrogenmaleate |
| CAS: | 521-78-8 |
| EINECS: | 208-318-3 |
| Molecular Formula: | C20H26N2 . C4H4O4 |
| Molecular Weight: | 410.56 |
| InChI: | InChI=1/C20H26N2.C4H4O4/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;5-3(6)1-2-4(7)8/h4-11,16H,12-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | 183.3°C |
| Boiling Point: | 411.8°Cat760mmHg |
| Density: | 1.029g/cm3 |
| Specification: | White Crystalline Solid usageEng:Antidepressant; serotonin transport blocker that also blocks norepinephrine uptake Safety Statements:26-36-45-33-24-16-7 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 33:Take precautionary measures against static discharges 24:Avoid contact with skin 16:Keep away from sources of ignition - No smoking 7:Keep container tightly closed |
| Packinggroup: | III |
| Flash Point: | 183.3°C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: |
Antidepressant; serotonin transport blocker that also blocks norepinephrine uptake |
| Safety Data | |
| Hazard Symbols | |
 |
|
