Identification |
Name: | 7-Hydroxy Prochlorperazine |
Synonyms: | 7-Hydroxy Prochlorperazine;8-Chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazin-3-ol |
CAS: | 52172-19-7 |
Molecular Formula: | C20H24ClN3OS |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H24ClN3OS/c1-22-9-11-23(12-10-22)7-2-8-24-17-5-4-16(25)14-20(17)26-19-6-3-15(21)13-18(19)24/h3-6,13-14,25H,2,7-12H2,1H3 |
Molecular Structure: |
![(C20H24ClN3OS) 7-Hydroxy Prochlorperazine;8-Chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazin-3-ol](https://img.guidechem.com/structure/52172-19-7.gif) |
Properties |
Melting Point: | 196-1970C |
Flash Point: | 298.503°C |
Boiling Point: | 569.962°C at 760 mmHg |
Density: | 1.276g/cm3 |
Refractive index: | 1.639 |
Specification: | Tan Crystalline Solid usageEng:A metabolite of Prochlorperazine |
Flash Point: | 298.503°C |
Usage: | A metabolite of Prochlorperazine |
Safety Data |
|
 |