| Identification | |
| Name: | Benzoic acid,3-formyl-, methyl ester |
| Synonyms: | Isophthalaldehydicacid, methyl ester (6CI,7CI);3-(Methoxycarbonyl)benzaldehyde;3-Carbomethoxybenzaldehyde;3-Formylbenzoic acid methyl ester;Methyl3-formylbenzoate;m-(Methoxycarbonyl)benzaldehyde; |
| CAS: | 52178-50-4 |
| Molecular Formula: | C9H8O3 |
| Molecular Weight: | 164.15802 |
| InChI: | InChI=1S/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 48-55 oC |
| Density: | 1.181 g/cm3 |
| Refractive index: | 1.557 |
| Water Solubility: | negligible in water |
| Solubility: | negligible in water |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
