| Identification | |
| Name: | 1,2-Ethanedione,1,2-di-2-furanyl-, 1,2-dioxime |
| Synonyms: | Ethanedione,di-2-furanyl-, dioxime (9CI); Furil, dioxime (6CI,7CI,8CI);Bis(2-furyl)glyoxime; Di-2-furylglyoxime; NSC 5055; a-Furil dioxime |
| CAS: | 522-27-0 |
| EINECS: | 208-326-7 |
| Molecular Formula: | C10H8 N2 O4 |
| Molecular Weight: | 220.1816 |
| InChI: | InChI=1S/C10H8N2O4/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8/h1-6,13-14H/b11-9+,12-10+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 155 °C |
| Flash Point: | 159.7°C |
| Boiling Point: | 340.5°Cat760mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.622 |
| Specification: |
Bis(2-furyl)glyoxime , its cas register number is 522-27-0. It also can be called 4-19-00-02008 (Beilstein Handbook Reference) ; BRN 0085894 ; Di-2-furylglyoxime ; EINECS 208-326-7 ; Ethanedione, di-2-furanyl-, dioxime ; Glyoxime, di-2-furyl- ; NSC 5055 ; alpha-Furil dioxime .When heated to decomposition it emits toxic vapors of NOx. Avoid Bis(2-furyl)glyoxime (CAS NO.522-27-0) contact with skin and eyes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 159.7°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
