Identification |
Name: | Butanoic acid, 2(or3)-methyl-,(2R,3S,6S,7R,8R)-3-[[3-(formylamino)-2-hydroxybenzoyl]amino]-8-butyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-ylester |
Synonyms: | Antimycin A3(6CI); Blastmycin (7CI); Butanoic acid, 3-methyl-,3-[[3-(formylamino)-2-hydroxybenzoyl]amino]-8-butyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-ylester, [2R-(2R*,3S*,6S*,7R*,8R*)]-; 1,5-Dioxonane, butanoic acid deriv.;Blastomycin; NSC 58239 |
CAS: | 522-70-3 |
EINECS: | 208-335-6 |
Molecular Formula: | C26H36 N2 O9 |
Molecular Weight: | 520.64 |
InChI: | InChI=1/C26H36N2O9/c1-6-7-9-18-23(37-20(30)12-14(2)3)16(5)36-26(34)21(15(4)35-25(18)33)28-24(32)17-10-8-11-19(22(17)31)27-13-29/h8,10-11,13-16,18,21,23,31H,6-7,9,12H2,1-5H3,(H,27,29)(H,28,32)/t15-,16+,18-,21+,23+/m1/s1 |
Molecular Structure: |
|
Properties |
Transport: | 3172 |
Flash Point: | 404.7°C |
Boiling Point: | 745.5°Cat760mmHg |
Density: | 1.25g/cm3 |
Refractive index: | 1.549 |
Specification: |
The extinguishing agent of Blastomycin (CAS NO.522-70-3 ) are dry powder, foam, sand, carbon dioxide, water mist.
|
Packinggroup: | II |
Flash Point: | 404.7°C |
Storage Temperature: | −20°C |
Safety Data |
|
|