| Identification | |
| Name: | N'-Acetyl ethylnitrosourea |
| Synonyms: | 1-Acetyl-3-ethyl-3-nitrosourea |
| CAS: | 52217-47-7 |
| Molecular Formula: | C5H9N3O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H9N3O3/c1-3-8(7-11)5(10)6-4(2)9/h3H2,1-2H3,(H,6,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.29g/cm3 |
| Refractive index: | 1.525 |
| Specification: |
N'-Acetyl ethylnitrosourea (CAS NO.52217-47-7) is also named as Acetamide, N-((ethylnitrosoamino)carbonyl)- ; Urea, 1-acetyl-3-ethylnitroso- . N'-Acetyl ethylnitrosourea (CAS NO.52217-47-7) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Safety Data | |
 |
|
